C13H11NO8 — CID 70122480
(2R)-2-[(1S)-1,2-dihydroxy-3-(3-nitrophenyl)cyclopropyl]-3,4-dihydroxy-2H-furan-5-one (PubChem CID 70122480) has the molecular formula C13H11NO8 and a molecular weight of 309.23 g/mol. Its IUPAC name is (2R)-2-[(1S)-1,2-dihydroxy-3-(3-nitrophenyl)cyclopropyl]-3,4-dihydroxy-2H-furan-5-one.
| Compound Name | (2R)-2-[(1S)-1,2-dihydroxy-3-(3-nitrophenyl)cyclopropyl]-3,4-dihydroxy-2H-furan-5-one |
|---|---|
| PubChem CID | 70122480 |
| Molecular Formula | C13H11NO8 |
| Molecular Weight | 309.23 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | (2R)-2-[(1S)-1,2-dihydroxy-3-(3-nitrophenyl)cyclopropyl]-3,4-dihydroxy-2H-furan-5-one |
| SMILES | O=C1O[C@H]([C@@]2(O)C(O)C2c2cccc([N+](=O)[O-])c2)C(O)=C1O |
| InChI | InChI=1S/C13H11NO8/c15-8-9(16)12(18)22-11(8)13(19)7(10(13)17)5-2-1-3-6(4-5)14(20)21/h1-4,7,10-11,15-17,19H/t7?,10?,11-,13-/m0/s1 |
| InChIKey | XXBJIKMDPDSHRY-HDXORGAJSA-N |
| XLogP | 0.04 |
| TPSA | 150.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.23 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|