C8H14O3 — CID 73236280
5-ethyl-2-propan-2-yl-1,3-dioxolan-4-one (PubChem CID 73236280) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is 5-ethyl-2-propan-2-yl-1,3-dioxolan-4-one.
| Compound Name | 5-ethyl-2-propan-2-yl-1,3-dioxolan-4-one |
|---|---|
| PubChem CID | 73236280 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 5-ethyl-2-propan-2-yl-1,3-dioxolan-4-one |
| SMILES | CCC1OC(C(C)C)OC1=O |
| InChI | InChI=1S/C8H14O3/c1-4-6-7(9)11-8(10-6)5(2)3/h5-6,8H,4H2,1-3H3 |
| InChIKey | SLQUYCBWCJUUBX-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |