C6H10O3 — CID 11819105
2-propan-2-yl-1,3-dioxolan-4-one (PubChem CID 11819105) has the molecular formula C6H10O3 and a molecular weight of 130.14 g/mol. Its IUPAC name is 2-propan-2-yl-1,3-dioxolan-4-one.
| Compound Name | 2-propan-2-yl-1,3-dioxolan-4-one |
|---|---|
| PubChem CID | 11819105 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | 2-propan-2-yl-1,3-dioxolan-4-one |
| SMILES | CC(C)C1OCC(=O)O1 |
| InChI | InChI=1S/C6H10O3/c1-4(2)6-8-3-5(7)9-6/h4,6H,3H2,1-2H3 |
| InChIKey | MZCOEPMHXQPZFF-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |