C6H12O3 — CID 144647860
ethane;2-methyl-1,3-dioxolan-4-one (PubChem CID 144647860) has the molecular formula C6H12O3 and a molecular weight of 132.16 g/mol. Its IUPAC name is ethane;2-methyl-1,3-dioxolan-4-one.
| Compound Name | ethane;2-methyl-1,3-dioxolan-4-one |
|---|---|
| PubChem CID | 144647860 |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | ethane;2-methyl-1,3-dioxolan-4-one |
| SMILES | CC.CC1OCC(=O)O1 |
| InChI | InChI=1S/C4H6O3.C2H6/c1-3-6-2-4(5)7-3;1-2/h3H,2H2,1H3;1-2H3 |
| InChIKey | VRPMFXTVJUSANX-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |