C4H7NO2 — CID 19595572
2-methyl-1,3-oxazolidin-5-one (PubChem CID 19595572) has the molecular formula C4H7NO2 and a molecular weight of 101.11 g/mol. Its IUPAC name is 2-methyl-1,3-oxazolidin-5-one.
| Compound Name | 2-methyl-1,3-oxazolidin-5-one |
|---|---|
| PubChem CID | 19595572 |
| Molecular Formula | C4H7NO2 |
| Molecular Weight | 101.11 g/mol |
| Exact Mass | 101.05 |
| IUPAC Name | 2-methyl-1,3-oxazolidin-5-one |
| SMILES | CC1NCC(=O)O1 |
| InChI | InChI=1S/C4H7NO2/c1-3-5-2-4(6)7-3/h3,5H,2H2,1H3 |
| InChIKey | QVEAUEQARWVRAV-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 101.11 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |