About ethane;(6S)-6-methylmorpholin-3-one
ethane;(6S)-6-methylmorpholin-3-one (PubChem CID 144732959) has the molecular formula C7H15NO2
and a molecular weight of 145.20 g/mol. Its IUPAC name is ethane;(6S)-6-methylmorpholin-3-one.
Molecular Properties
| Compound Name | ethane;(6S)-6-methylmorpholin-3-one |
| PubChem CID | 144732959 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | ethane;(6S)-6-methylmorpholin-3-one |
| SMILES | CC.C[C@H]1CNC(=O)CO1 |
| InChI | InChI=1S/C5H9NO2.C2H6/c1-4-2-6-5(7)3-8-4;1-2/h4H,2-3H2,1H3,(H,6,7);1-2H3/t4-;/m0./s1 |
| InChIKey | OYFQREMYLBJSCU-WCCKRBBISA-N |
| XLogP | 0.55 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;(6S)-6-methylmorpholin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(6S)-6-methylmorpholin-3-one?
The IUPAC name of ethane;(6S)-6-methylmorpholin-3-one (CID 144732959) is ethane;(6S)-6-methylmorpholin-3-one.
What is the SMILES notation for ethane;(6S)-6-methylmorpholin-3-one?
The canonical SMILES for ethane;(6S)-6-methylmorpholin-3-one is CC.C[C@H]1CNC(=O)CO1.
What is the InChIKey of ethane;(6S)-6-methylmorpholin-3-one?
The InChIKey is OYFQREMYLBJSCU-WCCKRBBISA-N. The full InChI is InChI=1S/C5H9NO2.C2H6/c1-4-2-6-5(7)3-8-4;1-2/h4H,2-3H2,1H3,(H,6,7);1-2H3/t4-;/m0./s1.
What are the key properties of ethane;(6S)-6-methylmorpholin-3-one?
ethane;(6S)-6-methylmorpholin-3-one has a molecular weight of 145.20 g/mol, XLogP of 0.55, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(6S)-6-methylmorpholin-3-one is sourced from PubChem (CID 144732959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).