C10H18N2O3 — CID 20681320
6,9,10-trimethyl-1,4,7-oxadiazecane-3,8-dione (PubChem CID 20681320) has the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. Its IUPAC name is 6,9,10-trimethyl-1,4,7-oxadiazecane-3,8-dione.
| Compound Name | 6,9,10-trimethyl-1,4,7-oxadiazecane-3,8-dione |
|---|---|
| PubChem CID | 20681320 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 6,9,10-trimethyl-1,4,7-oxadiazecane-3,8-dione |
| SMILES | CC1CNC(=O)COC(C)C(C)C(=O)N1 |
| InChI | InChI=1S/C10H18N2O3/c1-6-4-11-9(13)5-15-8(3)7(2)10(14)12-6/h6-8H,4-5H2,1-3H3,(H,11,13)(H,12,14) |
| InChIKey | YGYNTZQZCSJOQQ-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |