C5H9NO2 — CID 102354103
(4S,5S)-4-amino-5-methyloxolan-2-one (PubChem CID 102354103) has the molecular formula C5H9NO2 and a molecular weight of 115.13 g/mol. Its IUPAC name is (4S,5S)-4-amino-5-methyloxolan-2-one.
| Compound Name | (4S,5S)-4-amino-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 102354103 |
| Molecular Formula | C5H9NO2 |
| Molecular Weight | 115.13 g/mol |
| Exact Mass | 115.06 |
| IUPAC Name | (4S,5S)-4-amino-5-methyloxolan-2-one |
| SMILES | C[C@@H]1OC(=O)C[C@@H]1N |
| InChI | InChI=1S/C5H9NO2/c1-3-4(6)2-5(7)8-3/h3-4H,2,6H2,1H3/t3-,4-/m0/s1 |
| InChIKey | DLVYLQZKRIPAMS-IMJSIDKUSA-N |
| XLogP | -0.35 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.13 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |