C7H11BrO2 — CID 130020674
5-bromo-4,6-dimethyloxan-2-one (PubChem CID 130020674) has the molecular formula C7H11BrO2 and a molecular weight of 207.07 g/mol. Its IUPAC name is 5-bromo-4,6-dimethyloxan-2-one.
| Compound Name | 5-bromo-4,6-dimethyloxan-2-one |
|---|---|
| PubChem CID | 130020674 |
| Molecular Formula | C7H11BrO2 |
| Molecular Weight | 207.07 g/mol |
| Exact Mass | 205.99 |
| IUPAC Name | 5-bromo-4,6-dimethyloxan-2-one |
| SMILES | CC1CC(=O)OC(C)C1Br |
| InChI | InChI=1S/C7H11BrO2/c1-4-3-6(9)10-5(2)7(4)8/h4-5,7H,3H2,1-2H3 |
| InChIKey | UKVHZKKTKLNSLK-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.07 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|