C6H10O3 — CID 10820549
(4S,5R)-5-(hydroxymethyl)-4-methyloxolan-2-one (PubChem CID 10820549) has the molecular formula C6H10O3 and a molecular weight of 130.14 g/mol. Its IUPAC name is (4S,5R)-5-(hydroxymethyl)-4-methyloxolan-2-one.
| Compound Name | (4S,5R)-5-(hydroxymethyl)-4-methyloxolan-2-one |
|---|---|
| PubChem CID | 10820549 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | (4S,5R)-5-(hydroxymethyl)-4-methyloxolan-2-one |
| SMILES | C[C@H]1CC(=O)O[C@H]1CO |
| InChI | InChI=1S/C6H10O3/c1-4-2-6(8)9-5(4)3-7/h4-5,7H,2-3H2,1H3/t4-,5-/m0/s1 |
| InChIKey | FBTOCHKZAQZWSO-WHFBIAKZSA-N |
| XLogP | -0.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |