C14H26BO4 — CID 159220966
CID 159220966 (PubChem CID 159220966) has the molecular formula C14H26BO4 and a molecular weight of 269.17 g/mol.
| Compound Name | CID 159220966 |
|---|---|
| PubChem CID | 159220966 |
| Molecular Formula | C14H26BO4 |
| Molecular Weight | 269.17 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | — |
| SMILES | CC[C@@H]1OC(=O)C[C@@H]1C.CC[C@@H]1OC(O)C[C@@H]1C.[B] |
| InChI | InChI=1S/C7H14O2.C7H12O2.B/c2*1-3-6-5(2)4-7(8)9-6;/h5-8H,3-4H2,1-2H3;5-6H,3-4H2,1-2H3;/t5-,6-,7?;5-,6-;/m00./s1 |
| InChIKey | IBEWDNAROXBDJV-PXLSOTLWSA-N |
| XLogP | 2.11 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.17 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|