C6H10O3 — CID 165157557
2-methyl-6-(trideuteriomethyl)-1,3-dioxan-4-one (PubChem CID 165157557) has the molecular formula C6H10O3 and a molecular weight of 133.16 g/mol. Its IUPAC name is 2-methyl-6-(trideuteriomethyl)-1,3-dioxan-4-one.
| Compound Name | 2-methyl-6-(trideuteriomethyl)-1,3-dioxan-4-one |
|---|---|
| PubChem CID | 165157557 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 133.16 g/mol |
| Exact Mass | 133.08 |
| IUPAC Name | 2-methyl-6-(trideuteriomethyl)-1,3-dioxan-4-one |
| SMILES | [2H]C([2H])([2H])C1CC(=O)OC(C)O1 |
| InChI | InChI=1S/C6H10O3/c1-4-3-6(7)9-5(2)8-4/h4-5H,3H2,1-2H3/i1D3 |
| InChIKey | HXVQLRIDSYIHGU-FIBGUPNXSA-N |
| XLogP | 0.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.16 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |