C9H16O3 — CID 169243997
ethane;3-propan-2-yloxolane-2,4-dione (PubChem CID 169243997) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is ethane;3-propan-2-yloxolane-2,4-dione.
| Compound Name | ethane;3-propan-2-yloxolane-2,4-dione |
|---|---|
| PubChem CID | 169243997 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | ethane;3-propan-2-yloxolane-2,4-dione |
| SMILES | CC.CC(C)C1C(=O)COC1=O |
| InChI | InChI=1S/C7H10O3.C2H6/c1-4(2)6-5(8)3-10-7(6)9;1-2/h4,6H,3H2,1-2H3;1-2H3 |
| InChIKey | ILHFYXVHWACGMW-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|