C20H36O2 — CID 173164440
2-propan-2-ylcycloheptadecane-1,3-dione (PubChem CID 173164440) has the molecular formula C20H36O2 and a molecular weight of 308.51 g/mol. Its IUPAC name is 2-propan-2-ylcycloheptadecane-1,3-dione.
| Compound Name | 2-propan-2-ylcycloheptadecane-1,3-dione |
|---|---|
| PubChem CID | 173164440 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | 2-propan-2-ylcycloheptadecane-1,3-dione |
| SMILES | CC(C)C1C(=O)CCCCCCCCCCCCCCC1=O |
| InChI | InChI=1S/C20H36O2/c1-17(2)20-18(21)15-13-11-9-7-5-3-4-6-8-10-12-14-16-19(20)22/h17,20H,3-16H2,1-2H3 |
| InChIKey | IBZIFODRFMXNAK-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|