C9H15IO2 — CID 11076883
(3S,4R,5R)-5-(iodomethyl)-3-methyl-4-propyloxolan-2-one (PubChem CID 11076883) has the molecular formula C9H15IO2 and a molecular weight of 282.12 g/mol. Its IUPAC name is (3S,4R,5R)-5-(iodomethyl)-3-methyl-4-propyloxolan-2-one.
| Compound Name | (3S,4R,5R)-5-(iodomethyl)-3-methyl-4-propyloxolan-2-one |
|---|---|
| PubChem CID | 11076883 |
| Molecular Formula | C9H15IO2 |
| Molecular Weight | 282.12 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | (3S,4R,5R)-5-(iodomethyl)-3-methyl-4-propyloxolan-2-one |
| SMILES | CCC[C@H]1[C@H](CI)OC(=O)[C@H]1C |
| InChI | InChI=1S/C9H15IO2/c1-3-4-7-6(2)9(11)12-8(7)5-10/h6-8H,3-5H2,1-2H3/t6-,7+,8-/m0/s1 |
| InChIKey | LMNRHNSDRAICCC-RNJXMRFFSA-N |
| XLogP | 2.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.12 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|