C11H19O5P — CID 132518276
(1S,5S)-1-diethoxyphosphoryl-6,6-dimethyl-3-oxabicyclo[3.1.0]hexan-2-one (PubChem CID 132518276) has the molecular formula C11H19O5P and a molecular weight of 262.24 g/mol. Its IUPAC name is (1S,5S)-1-diethoxyphosphoryl-6,6-dimethyl-3-oxabicyclo[3.1.0]hexan-2-one.
| Compound Name | (1S,5S)-1-diethoxyphosphoryl-6,6-dimethyl-3-oxabicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 132518276 |
| Molecular Formula | C11H19O5P |
| Molecular Weight | 262.24 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | (1S,5S)-1-diethoxyphosphoryl-6,6-dimethyl-3-oxabicyclo[3.1.0]hexan-2-one |
| SMILES | CCOP(=O)(OCC)[C@@]12C(=O)OC[C@@H]1C2(C)C |
| InChI | InChI=1S/C11H19O5P/c1-5-15-17(13,16-6-2)11-8(10(11,3)4)7-14-9(11)12/h8H,5-7H2,1-4H3/t8-,11-/m1/s1 |
| InChIKey | HXROJMXNWPAERY-LDYMZIIASA-N |
| XLogP | 2.20 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.24 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|