C19H21O6P — CID 15418526
2-acetyl-1-diethoxyphosphoryl-1,2-dihydrobenzo[f]chromen-3-one (PubChem CID 15418526) has the molecular formula C19H21O6P and a molecular weight of 376.35 g/mol. Its IUPAC name is 2-acetyl-1-diethoxyphosphoryl-1,2-dihydrobenzo[f]chromen-3-one.
| Compound Name | 2-acetyl-1-diethoxyphosphoryl-1,2-dihydrobenzo[f]chromen-3-one |
|---|---|
| PubChem CID | 15418526 |
| Molecular Formula | C19H21O6P |
| Molecular Weight | 376.35 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 2-acetyl-1-diethoxyphosphoryl-1,2-dihydrobenzo[f]chromen-3-one |
| SMILES | CCOP(=O)(OCC)C1c2c(ccc3ccccc23)OC(=O)C1C(C)=O |
| InChI | InChI=1S/C19H21O6P/c1-4-23-26(22,24-5-2)18-16(12(3)20)19(21)25-15-11-10-13-8-6-7-9-14(13)17(15)18/h6-11,16,18H,4-5H2,1-3H3 |
| InChIKey | NESMHIVZQJXXPS-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.35 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|