C19H19NO5 — CID 12612716
ethyl 2-(2-methyl-3-oxo-1H-benzo[f][1,3]benzoxazin-1-yl)-3-oxobutanoate (PubChem CID 12612716) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is ethyl 2-(2-methyl-3-oxo-1H-benzo[f][1,3]benzoxazin-1-yl)-3-oxobutanoate.
| Compound Name | ethyl 2-(2-methyl-3-oxo-1H-benzo[f][1,3]benzoxazin-1-yl)-3-oxobutanoate |
|---|---|
| PubChem CID | 12612716 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | ethyl 2-(2-methyl-3-oxo-1H-benzo[f][1,3]benzoxazin-1-yl)-3-oxobutanoate |
| SMILES | CCOC(=O)C(C(C)=O)C1c2c(ccc3ccccc23)OC(=O)N1C |
| InChI | InChI=1S/C19H19NO5/c1-4-24-18(22)15(11(2)21)17-16-13-8-6-5-7-12(13)9-10-14(16)25-19(23)20(17)3/h5-10,15,17H,4H2,1-3H3 |
| InChIKey | IUUHGZVMMJEFSR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|