C26H21NO2 — CID 101367290
1-phenyl-2-[(1R)-1-phenylethyl]-1H-benzo[f][1,3]benzoxazin-3-one (PubChem CID 101367290) has the molecular formula C26H21NO2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 1-phenyl-2-[(1R)-1-phenylethyl]-1H-benzo[f][1,3]benzoxazin-3-one.
| Compound Name | 1-phenyl-2-[(1R)-1-phenylethyl]-1H-benzo[f][1,3]benzoxazin-3-one |
|---|---|
| PubChem CID | 101367290 |
| Molecular Formula | C26H21NO2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 1-phenyl-2-[(1R)-1-phenylethyl]-1H-benzo[f][1,3]benzoxazin-3-one |
| SMILES | C[C@H](c1ccccc1)N1C(=O)Oc2ccc3ccccc3c2C1c1ccccc1 |
| InChI | InChI=1S/C26H21NO2/c1-18(19-10-4-2-5-11-19)27-25(21-13-6-3-7-14-21)24-22-15-9-8-12-20(22)16-17-23(24)29-26(27)28/h2-18,25H,1H3/t18-,25?/m1/s1 |
| InChIKey | VKOLIXONIZWEFB-YDONVPIESA-N |
| XLogP | 6.50 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |