C25H17NO3 — CID 101424252
(2S,10S)-10-phenyl-9,13-dioxa-11-azapentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),3,5,7,15,17,19,21-octaen-12-one (PubChem CID 101424252) has the molecular formula C25H17NO3 and a molecular weight of 379.42 g/mol. Its IUPAC name is (2S,10S)-10-phenyl-9,13-dioxa-11-azapentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),3,5,7,15,17,19,21-octaen-12-one.
| Compound Name | (2S,10S)-10-phenyl-9,13-dioxa-11-azapentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),3,5,7,15,17,19,21-octaen-12-one |
|---|---|
| PubChem CID | 101424252 |
| Molecular Formula | C25H17NO3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | (2S,10S)-10-phenyl-9,13-dioxa-11-azapentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),3,5,7,15,17,19,21-octaen-12-one |
| SMILES | O=C1Oc2ccc3ccccc3c2[C@@H]2c3ccccc3O[C@@H](c3ccccc3)N12 |
| InChI | InChI=1S/C25H17NO3/c27-25-26-23(22-18-11-5-4-8-16(18)14-15-21(22)29-25)19-12-6-7-13-20(19)28-24(26)17-9-2-1-3-10-17/h1-15,23-24H/t23-,24-/m0/s1 |
| InChIKey | SAVBCDWLIVVNMN-ZEQRLZLVSA-N |
| XLogP | 5.83 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |