C26H21NO — CID 162398766
(2R,14S)-2-phenyl-13-oxa-1-azapentacyclo[12.8.0.03,12.04,9.015,20]docosa-3(12),4,6,8,10,15,17,19-octaene (PubChem CID 162398766) has the molecular formula C26H21NO and a molecular weight of 363.46 g/mol. Its IUPAC name is (2R,14S)-2-phenyl-13-oxa-1-azapentacyclo[12.8.0.03,12.04,9.015,20]docosa-3(12),4,6,8,10,15,17,19-octaene.
| Compound Name | (2R,14S)-2-phenyl-13-oxa-1-azapentacyclo[12.8.0.03,12.04,9.015,20]docosa-3(12),4,6,8,10,15,17,19-octaene |
|---|---|
| PubChem CID | 162398766 |
| Molecular Formula | C26H21NO |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | (2R,14S)-2-phenyl-13-oxa-1-azapentacyclo[12.8.0.03,12.04,9.015,20]docosa-3(12),4,6,8,10,15,17,19-octaene |
| SMILES | c1ccc([C@@H]2c3c(ccc4ccccc34)O[C@H]3c4ccccc4CCN23)cc1 |
| InChI | InChI=1S/C26H21NO/c1-2-10-20(11-3-1)25-24-21-12-6-4-8-18(21)14-15-23(24)28-26-22-13-7-5-9-19(22)16-17-27(25)26/h1-15,25-26H,16-17H2/t25-,26+/m1/s1 |
| InChIKey | GPAHALNWVFBLQP-FTJBHMTQSA-N |
| XLogP | 5.88 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |