C29H23ClN2O2 — CID 139193177
[(9S,14aS)-9-(4-chlorophenyl)-5,6,9,14a-tetrahydroisoquinolino[1,2-b][1,3,4]benzoxadiazepin-8-yl]-phenylmethanone (PubChem CID 139193177) has the molecular formula C29H23ClN2O2 and a molecular weight of 466.97 g/mol. Its IUPAC name is [(9S,14aS)-9-(4-chlorophenyl)-5,6,9,14a-tetrahydroisoquinolino[1,2-b][1,3,4]benzoxadiazepin-8-yl]-phenylmethanone.
| Compound Name | [(9S,14aS)-9-(4-chlorophenyl)-5,6,9,14a-tetrahydroisoquinolino[1,2-b][1,3,4]benzoxadiazepin-8-yl]-phenylmethanone |
|---|---|
| PubChem CID | 139193177 |
| Molecular Formula | C29H23ClN2O2 |
| Molecular Weight | 466.97 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | [(9S,14aS)-9-(4-chlorophenyl)-5,6,9,14a-tetrahydroisoquinolino[1,2-b][1,3,4]benzoxadiazepin-8-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1[C@@H](c2ccc(Cl)cc2)c2ccccc2O[C@H]2c3ccccc3CCN21 |
| InChI | InChI=1S/C29H23ClN2O2/c30-23-16-14-21(15-17-23)27-25-12-6-7-13-26(25)34-29-24-11-5-4-8-20(24)18-19-31(29)32(27)28(33)22-9-2-1-3-10-22/h1-17,27,29H,18-19H2/t27-,29-/m0/s1 |
| InChIKey | KGLORROLAZZTAZ-YTMVLYRLSA-N |
| XLogP | 6.44 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.97 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |