C26H21ClN2O2 — CID 132513003
(3Z)-4-benzoyl-3-[(4-chlorophenyl)methylidene]-1,6,7,11b-tetrahydropyridazino[6,1-a]isoquinolin-2-one (PubChem CID 132513003) has the molecular formula C26H21ClN2O2 and a molecular weight of 428.92 g/mol. Its IUPAC name is (3Z)-4-benzoyl-3-[(4-chlorophenyl)methylidene]-1,6,7,11b-tetrahydropyridazino[6,1-a]isoquinolin-2-one.
| Compound Name | (3Z)-4-benzoyl-3-[(4-chlorophenyl)methylidene]-1,6,7,11b-tetrahydropyridazino[6,1-a]isoquinolin-2-one |
|---|---|
| PubChem CID | 132513003 |
| Molecular Formula | C26H21ClN2O2 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | (3Z)-4-benzoyl-3-[(4-chlorophenyl)methylidene]-1,6,7,11b-tetrahydropyridazino[6,1-a]isoquinolin-2-one |
| SMILES | O=C1CC2c3ccccc3CCN2N(C(=O)c2ccccc2)/C1=C\c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H21ClN2O2/c27-21-12-10-18(11-13-21)16-24-25(30)17-23-22-9-5-4-6-19(22)14-15-28(23)29(24)26(31)20-7-2-1-3-8-20/h1-13,16,23H,14-15,17H2/b24-16- |
| InChIKey | QPUMQDFLXNCAKV-JLPGSUDCSA-N |
| XLogP | 5.31 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|