C25H20N2O2 — CID 102150377
(2E)-1-benzoyl-2-benzylidene-6,10b-dihydro-5H-imidazo[2,1-a]isoquinolin-3-one (PubChem CID 102150377) has the molecular formula C25H20N2O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is (2E)-1-benzoyl-2-benzylidene-6,10b-dihydro-5H-imidazo[2,1-a]isoquinolin-3-one.
| Compound Name | (2E)-1-benzoyl-2-benzylidene-6,10b-dihydro-5H-imidazo[2,1-a]isoquinolin-3-one |
|---|---|
| PubChem CID | 102150377 |
| Molecular Formula | C25H20N2O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | (2E)-1-benzoyl-2-benzylidene-6,10b-dihydro-5H-imidazo[2,1-a]isoquinolin-3-one |
| SMILES | O=C1/C(=C\c2ccccc2)N(C(=O)c2ccccc2)C2c3ccccc3CCN12 |
| InChI | InChI=1S/C25H20N2O2/c28-24(20-12-5-2-6-13-20)27-22(17-18-9-3-1-4-10-18)25(29)26-16-15-19-11-7-8-14-21(19)23(26)27/h1-14,17,23H,15-16H2/b22-17+ |
| InChIKey | MYQQTISKENOVNH-OQKWZONESA-N |
| XLogP | 4.27 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|