C19H18ClNO2 — CID 140922704
2-[(3R,10bS)-3,5,6,10b-tetrahydro-2H-[1,3]oxazolo[2,3-a]isoquinolin-3-yl]-1-(4-chlorophenyl)ethanone (PubChem CID 140922704) has the molecular formula C19H18ClNO2 and a molecular weight of 327.81 g/mol. Its IUPAC name is 2-[(3R,10bS)-3,5,6,10b-tetrahydro-2H-[1,3]oxazolo[2,3-a]isoquinolin-3-yl]-1-(4-chlorophenyl)ethanone.
| Compound Name | 2-[(3R,10bS)-3,5,6,10b-tetrahydro-2H-[1,3]oxazolo[2,3-a]isoquinolin-3-yl]-1-(4-chlorophenyl)ethanone |
|---|---|
| PubChem CID | 140922704 |
| Molecular Formula | C19H18ClNO2 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 2-[(3R,10bS)-3,5,6,10b-tetrahydro-2H-[1,3]oxazolo[2,3-a]isoquinolin-3-yl]-1-(4-chlorophenyl)ethanone |
| SMILES | O=C(C[C@@H]1CO[C@H]2c3ccccc3CCN12)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H18ClNO2/c20-15-7-5-14(6-8-15)18(22)11-16-12-23-19-17-4-2-1-3-13(17)9-10-21(16)19/h1-8,16,19H,9-12H2/t16-,19+/m1/s1 |
| InChIKey | FSKCPFGAKUKDMX-APWZRJJASA-N |
| XLogP | 3.87 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |