C19H17ClO4 — CID 132602979
methyl 3-(4-chlorophenyl)-2-(3,4-dihydro-1H-isochromen-1-yl)-3-oxopropanoate (PubChem CID 132602979) has the molecular formula C19H17ClO4 and a molecular weight of 344.79 g/mol. Its IUPAC name is methyl 3-(4-chlorophenyl)-2-(3,4-dihydro-1H-isochromen-1-yl)-3-oxopropanoate.
| Compound Name | methyl 3-(4-chlorophenyl)-2-(3,4-dihydro-1H-isochromen-1-yl)-3-oxopropanoate |
|---|---|
| PubChem CID | 132602979 |
| Molecular Formula | C19H17ClO4 |
| Molecular Weight | 344.79 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | methyl 3-(4-chlorophenyl)-2-(3,4-dihydro-1H-isochromen-1-yl)-3-oxopropanoate |
| SMILES | COC(=O)C(C(=O)c1ccc(Cl)cc1)C1OCCc2ccccc21 |
| InChI | InChI=1S/C19H17ClO4/c1-23-19(22)16(17(21)13-6-8-14(20)9-7-13)18-15-5-3-2-4-12(15)10-11-24-18/h2-9,16,18H,10-11H2,1H3 |
| InChIKey | VXSDSQJMRCJPJV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.79 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|