C16H11F3O2 — CID 105098967
3,4-dihydro-1H-isochromen-1-yl-(2,3,4-trifluorophenyl)methanone (PubChem CID 105098967) has the molecular formula C16H11F3O2 and a molecular weight of 292.26 g/mol. Its IUPAC name is 3,4-dihydro-1H-isochromen-1-yl-(2,3,4-trifluorophenyl)methanone.
| Compound Name | 3,4-dihydro-1H-isochromen-1-yl-(2,3,4-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 105098967 |
| Molecular Formula | C16H11F3O2 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 3,4-dihydro-1H-isochromen-1-yl-(2,3,4-trifluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)c(F)c1F)C1OCCc2ccccc21 |
| InChI | InChI=1S/C16H11F3O2/c17-12-6-5-11(13(18)14(12)19)15(20)16-10-4-2-1-3-9(10)7-8-21-16/h1-6,16H,7-8H2 |
| InChIKey | QDUFWRFKXYEFLT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|