C18H14O2S — CID 105122149
1-benzothiophen-7-yl(3,4-dihydro-1H-isochromen-1-yl)methanone (PubChem CID 105122149) has the molecular formula C18H14O2S and a molecular weight of 294.38 g/mol. Its IUPAC name is 1-benzothiophen-7-yl(3,4-dihydro-1H-isochromen-1-yl)methanone.
| Compound Name | 1-benzothiophen-7-yl(3,4-dihydro-1H-isochromen-1-yl)methanone |
|---|---|
| PubChem CID | 105122149 |
| Molecular Formula | C18H14O2S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 1-benzothiophen-7-yl(3,4-dihydro-1H-isochromen-1-yl)methanone |
| SMILES | O=C(c1cccc2ccsc12)C1OCCc2ccccc21 |
| InChI | InChI=1S/C18H14O2S/c19-16(15-7-3-5-13-9-11-21-18(13)15)17-14-6-2-1-4-12(14)8-10-20-17/h1-7,9,11,17H,8,10H2 |
| InChIKey | VEIAFFZFEZIQAQ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |