C24H23NO — CID 46196603
(12R,16R,18S)-16-ethenyl-18-phenyl-11-oxa-17-azatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8-pentaene (PubChem CID 46196603) has the molecular formula C24H23NO and a molecular weight of 341.45 g/mol. Its IUPAC name is (12R,16R,18S)-16-ethenyl-18-phenyl-11-oxa-17-azatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8-pentaene.
| Compound Name | (12R,16R,18S)-16-ethenyl-18-phenyl-11-oxa-17-azatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8-pentaene |
|---|---|
| PubChem CID | 46196603 |
| Molecular Formula | C24H23NO |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | (12R,16R,18S)-16-ethenyl-18-phenyl-11-oxa-17-azatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8-pentaene |
| SMILES | C=C[C@H]1CCC[C@H]2Oc3ccc4ccccc4c3[C@H](c3ccccc3)N12 |
| InChI | InChI=1S/C24H23NO/c1-2-19-12-8-14-22-25(19)24(18-10-4-3-5-11-18)23-20-13-7-6-9-17(20)15-16-21(23)26-22/h2-7,9-11,13,15-16,19,22,24H,1,8,12,14H2/t19-,22+,24-/m0/s1 |
| InChIKey | OYQBDTRAUOHYKY-KWOQKUFVSA-N |
| XLogP | 5.69 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|