C26H27NO — CID 46198137
(12R,16R,18S)-16-but-3-enyl-18-phenyl-11-oxa-17-azatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8-pentaene (PubChem CID 46198137) has the molecular formula C26H27NO and a molecular weight of 369.51 g/mol. Its IUPAC name is (12R,16R,18S)-16-but-3-enyl-18-phenyl-11-oxa-17-azatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8-pentaene.
| Compound Name | (12R,16R,18S)-16-but-3-enyl-18-phenyl-11-oxa-17-azatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8-pentaene |
|---|---|
| PubChem CID | 46198137 |
| Molecular Formula | C26H27NO |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | (12R,16R,18S)-16-but-3-enyl-18-phenyl-11-oxa-17-azatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8-pentaene |
| SMILES | C=CCC[C@H]1CCC[C@H]2Oc3ccc4ccccc4c3[C@H](c3ccccc3)N12 |
| InChI | InChI=1S/C26H27NO/c1-2-3-13-21-14-9-16-24-27(21)26(20-11-5-4-6-12-20)25-22-15-8-7-10-19(22)17-18-23(25)28-24/h2,4-8,10-12,15,17-18,21,24,26H,1,3,9,13-14,16H2/t21-,24+,26-/m0/s1 |
| InChIKey | CRTVCQHGXKJPJW-NZJKTDFXSA-N |
| XLogP | 6.47 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|