C30H37NO — CID 45276683
1-[(R)-[(2R)-2-oct-7-enylpiperidin-1-yl]-phenylmethyl]naphthalen-2-ol (PubChem CID 45276683) has the molecular formula C30H37NO and a molecular weight of 427.63 g/mol. Its IUPAC name is 1-[(R)-[(2R)-2-oct-7-enylpiperidin-1-yl]-phenylmethyl]naphthalen-2-ol.
| Compound Name | 1-[(R)-[(2R)-2-oct-7-enylpiperidin-1-yl]-phenylmethyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 45276683 |
| Molecular Formula | C30H37NO |
| Molecular Weight | 427.63 g/mol |
| Exact Mass | 427.29 |
| IUPAC Name | 1-[(R)-[(2R)-2-oct-7-enylpiperidin-1-yl]-phenylmethyl]naphthalen-2-ol |
| SMILES | C=CCCCCCC[C@@H]1CCCCN1[C@H](c1ccccc1)c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C30H37NO/c1-2-3-4-5-6-10-18-26-19-13-14-23-31(26)30(25-16-8-7-9-17-25)29-27-20-12-11-15-24(27)21-22-28(29)32/h2,7-9,11-12,15-17,20-22,26,30,32H,1,3-6,10,13-14,18-19,23H2/t26-,30-/m1/s1 |
| InChIKey | OTVHTGOXMLKUIJ-PDDLMNHVSA-N |
| XLogP | 8.02 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.63 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|