C19H16O2 — CID 14316337
1-phenyl-2,3-dihydro-1H-benzo[f]chromen-3-ol (PubChem CID 14316337) has the molecular formula C19H16O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is 1-phenyl-2,3-dihydro-1H-benzo[f]chromen-3-ol.
| Compound Name | 1-phenyl-2,3-dihydro-1H-benzo[f]chromen-3-ol |
|---|---|
| PubChem CID | 14316337 |
| Molecular Formula | C19H16O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 1-phenyl-2,3-dihydro-1H-benzo[f]chromen-3-ol |
| SMILES | OC1CC(c2ccccc2)c2c(ccc3ccccc23)O1 |
| InChI | InChI=1S/C19H16O2/c20-18-12-16(13-6-2-1-3-7-13)19-15-9-5-4-8-14(15)10-11-17(19)21-18/h1-11,16,18,20H,12H2 |
| InChIKey | VVZMUDUHVNSBAM-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |