C15H14O — CID 4867516
11-oxatetracyclo[8.6.0.02,7.012,16]hexadeca-1(10),2,4,6,8-pentaene (PubChem CID 4867516) has the molecular formula C15H14O and a molecular weight of 210.28 g/mol. Its IUPAC name is 11-oxatetracyclo[8.6.0.02,7.012,16]hexadeca-1(10),2,4,6,8-pentaene.
| Compound Name | 11-oxatetracyclo[8.6.0.02,7.012,16]hexadeca-1(10),2,4,6,8-pentaene |
|---|---|
| PubChem CID | 4867516 |
| Molecular Formula | C15H14O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 11-oxatetracyclo[8.6.0.02,7.012,16]hexadeca-1(10),2,4,6,8-pentaene |
| SMILES | c1ccc2c3c(ccc2c1)OC1CCCC31 |
| InChI | InChI=1S/C15H14O/c1-2-5-11-10(4-1)8-9-14-15(11)12-6-3-7-13(12)16-14/h1-2,4-5,8-9,12-13H,3,6-7H2 |
| InChIKey | OMPJKSIMSQUWGB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |