C26H26O5 — CID 139234365
12-(3,4,5-trimethoxyphenyl)-7a,8,9,10,11a,12-hexahydrobenzo[a]xanthen-11-one (PubChem CID 139234365) has the molecular formula C26H26O5 and a molecular weight of 418.49 g/mol. Its IUPAC name is 12-(3,4,5-trimethoxyphenyl)-7a,8,9,10,11a,12-hexahydrobenzo[a]xanthen-11-one.
| Compound Name | 12-(3,4,5-trimethoxyphenyl)-7a,8,9,10,11a,12-hexahydrobenzo[a]xanthen-11-one |
|---|---|
| PubChem CID | 139234365 |
| Molecular Formula | C26H26O5 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 12-(3,4,5-trimethoxyphenyl)-7a,8,9,10,11a,12-hexahydrobenzo[a]xanthen-11-one |
| SMILES | COc1cc(C2c3c(ccc4ccccc34)OC3CCCC(=O)C32)cc(OC)c1OC |
| InChI | InChI=1S/C26H26O5/c1-28-21-13-16(14-22(29-2)26(21)30-3)23-24-17-8-5-4-7-15(17)11-12-20(24)31-19-10-6-9-18(27)25(19)23/h4-5,7-8,11-14,19,23,25H,6,9-10H2,1-3H3 |
| InChIKey | SBVTUEBRWAEXBG-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |