C18H19IO3 — CID 101149284
(3R)-3-(1,3-dimethoxynaphthalen-2-yl)-2-iodocyclohexan-1-one (PubChem CID 101149284) has the molecular formula C18H19IO3 and a molecular weight of 410.25 g/mol. Its IUPAC name is (3R)-3-(1,3-dimethoxynaphthalen-2-yl)-2-iodocyclohexan-1-one.
| Compound Name | (3R)-3-(1,3-dimethoxynaphthalen-2-yl)-2-iodocyclohexan-1-one |
|---|---|
| PubChem CID | 101149284 |
| Molecular Formula | C18H19IO3 |
| Molecular Weight | 410.25 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | (3R)-3-(1,3-dimethoxynaphthalen-2-yl)-2-iodocyclohexan-1-one |
| SMILES | COc1cc2ccccc2c(OC)c1[C@H]1CCCC(=O)C1I |
| InChI | InChI=1S/C18H19IO3/c1-21-15-10-11-6-3-4-7-12(11)18(22-2)16(15)13-8-5-9-14(20)17(13)19/h3-4,6-7,10,13,17H,5,8-9H2,1-2H3/t13-,17?/m1/s1 |
| InChIKey | XZOHDHHAFVWKTO-FWJOYPJLSA-N |
| XLogP | 4.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.25 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|