About (3R)-3-(1,3-dimethoxynaphthalen-2-yl)-2-iodocyclohexan-1-one
(3R)-3-(1,3-dimethoxynaphthalen-2-yl)-2-iodocyclohexan-1-one (PubChem CID 101149284) has the molecular formula C18H19IO3
and a molecular weight of 410.25 g/mol. Its IUPAC name is (3R)-3-(1,3-dimethoxynaphthalen-2-yl)-2-iodocyclohexan-1-one.
Molecular Properties
| Compound Name | (3R)-3-(1,3-dimethoxynaphthalen-2-yl)-2-iodocyclohexan-1-one |
| PubChem CID | 101149284 |
| Molecular Formula | C18H19IO3 |
| Molecular Weight | 410.25 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | (3R)-3-(1,3-dimethoxynaphthalen-2-yl)-2-iodocyclohexan-1-one |
| SMILES | COc1cc2ccccc2c(OC)c1[C@H]1CCCC(=O)C1I |
| InChI | InChI=1S/C18H19IO3/c1-21-15-10-11-6-3-4-7-12(11)18(22-2)16(15)13-8-5-9-14(20)17(13)19/h3-4,6-7,10,13,17H,5,8-9H2,1-2H3/t13-,17?/m1/s1 |
| InChIKey | XZOHDHHAFVWKTO-FWJOYPJLSA-N |
| XLogP | 4.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.25 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-(1,3-dimethoxynaphthalen-2-yl)-2-iodocyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-(1,3-dimethoxynaphthalen-2-yl)-2-iodocyclohexan-1-one?
The IUPAC name of (3R)-3-(1,3-dimethoxynaphthalen-2-yl)-2-iodocyclohexan-1-one (CID 101149284) is (3R)-3-(1,3-dimethoxynaphthalen-2-yl)-2-iodocyclohexan-1-one.
What is the SMILES notation for (3R)-3-(1,3-dimethoxynaphthalen-2-yl)-2-iodocyclohexan-1-one?
The canonical SMILES for (3R)-3-(1,3-dimethoxynaphthalen-2-yl)-2-iodocyclohexan-1-one is COc1cc2ccccc2c(OC)c1[C@H]1CCCC(=O)C1I.
What is the InChIKey of (3R)-3-(1,3-dimethoxynaphthalen-2-yl)-2-iodocyclohexan-1-one?
The InChIKey is XZOHDHHAFVWKTO-FWJOYPJLSA-N. The full InChI is InChI=1S/C18H19IO3/c1-21-15-10-11-6-3-4-7-12(11)18(22-2)16(15)13-8-5-9-14(20)17(13)19/h3-4,6-7,10,13,17H,5,8-9H2,1-2H3/t13-,17?/m1/s1.
What are the key properties of (3R)-3-(1,3-dimethoxynaphthalen-2-yl)-2-iodocyclohexan-1-one?
(3R)-3-(1,3-dimethoxynaphthalen-2-yl)-2-iodocyclohexan-1-one has a molecular weight of 410.25 g/mol, XLogP of 4.50, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-(1,3-dimethoxynaphthalen-2-yl)-2-iodocyclohexan-1-one is sourced from PubChem (CID 101149284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).