C16H14O4 — CID 129363201
(2S)-9-methoxy-4-oxo-2,3-dihydro-1H-anthracene-2-carboxylic acid (PubChem CID 129363201) has the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. Its IUPAC name is (2S)-9-methoxy-4-oxo-2,3-dihydro-1H-anthracene-2-carboxylic acid.
| Compound Name | (2S)-9-methoxy-4-oxo-2,3-dihydro-1H-anthracene-2-carboxylic acid |
|---|---|
| PubChem CID | 129363201 |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | (2S)-9-methoxy-4-oxo-2,3-dihydro-1H-anthracene-2-carboxylic acid |
| SMILES | COc1c2c(cc3ccccc13)C(=O)C[C@@H](C(=O)O)C2 |
| InChI | InChI=1S/C16H14O4/c1-20-15-11-5-3-2-4-9(11)6-12-13(15)7-10(16(18)19)8-14(12)17/h2-6,10H,7-8H2,1H3,(H,18,19)/t10-/m0/s1 |
| InChIKey | UWOUICCFCALLTI-JTQLQIEISA-N |
| XLogP | 2.68 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |