C14H12O3 — CID 101041214
(11S,15S)-2,16-dioxatetracyclo[8.6.0.03,8.011,15]hexadeca-1(10),3,5,7-tetraen-9-one (PubChem CID 101041214) has the molecular formula C14H12O3 and a molecular weight of 228.25 g/mol. Its IUPAC name is (11S,15S)-2,16-dioxatetracyclo[8.6.0.03,8.011,15]hexadeca-1(10),3,5,7-tetraen-9-one.
| Compound Name | (11S,15S)-2,16-dioxatetracyclo[8.6.0.03,8.011,15]hexadeca-1(10),3,5,7-tetraen-9-one |
|---|---|
| PubChem CID | 101041214 |
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | (11S,15S)-2,16-dioxatetracyclo[8.6.0.03,8.011,15]hexadeca-1(10),3,5,7-tetraen-9-one |
| SMILES | O=c1c2c(oc3ccccc13)O[C@H]1CCC[C@@H]21 |
| InChI | InChI=1S/C14H12O3/c15-13-9-4-1-2-6-11(9)17-14-12(13)8-5-3-7-10(8)16-14/h1-2,4,6,8,10H,3,5,7H2/t8-,10+/m1/s1 |
| InChIKey | DIPFIQPZNNNKNA-SCZZXKLOSA-N |
| XLogP | 2.82 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |