C14H11O3 — CID 101070743
CID 101070743 (PubChem CID 101070743) has the molecular formula C14H11O3 and a molecular weight of 227.24 g/mol.
| Compound Name | CID 101070743 |
|---|---|
| PubChem CID | 101070743 |
| Molecular Formula | C14H11O3 |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | — |
| SMILES | O=c1oc2ccccc2c2c1C1CC[CH]C1O2 |
| InChI | InChI=1S/C14H11O3/c15-14-12-8-5-3-7-10(8)16-13(12)9-4-1-2-6-11(9)17-14/h1-2,4,6-8,10H,3,5H2 |
| InChIKey | USGUYMWYEHQVRO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|