C14H11HgO3 — CID 10323153
[(12S,16R)-9-oxo-8,11-dioxatetracyclo[8.6.0.02,7.012,16]hexadeca-1(10),2,4,6-tetraen-13-yl]mercury (PubChem CID 10323153) has the molecular formula C14H11HgO3 and a molecular weight of 427.83 g/mol. Its IUPAC name is [(12S,16R)-9-oxo-8,11-dioxatetracyclo[8.6.0.02,7.012,16]hexadeca-1(10),2,4,6-tetraen-13-yl]mercury.
| Compound Name | [(12S,16R)-9-oxo-8,11-dioxatetracyclo[8.6.0.02,7.012,16]hexadeca-1(10),2,4,6-tetraen-13-yl]mercury |
|---|---|
| PubChem CID | 10323153 |
| Molecular Formula | C14H11HgO3 |
| Molecular Weight | 427.83 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | [(12S,16R)-9-oxo-8,11-dioxatetracyclo[8.6.0.02,7.012,16]hexadeca-1(10),2,4,6-tetraen-13-yl]mercury |
| SMILES | O=c1oc2ccccc2c2c1O[C@@H]1C([Hg])CC[C@H]21 |
| InChI | InChI=1S/C14H11O3.Hg/c15-14-13-12(9-5-3-7-10(9)16-13)8-4-1-2-6-11(8)17-14;/h1-2,4,6-7,9-10H,3,5H2;/t9-,10+;/m0./s1 |
| InChIKey | PBGHJUDHBOMGMW-BAUSSPIASA-N |
| XLogP | 2.77 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.83 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|