C13H13NO2 — CID 12051006
1-methyl-1,2,3,4-tetrahydrochromeno[3,4-b]pyridin-5-one (PubChem CID 12051006) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is 1-methyl-1,2,3,4-tetrahydrochromeno[3,4-b]pyridin-5-one.
| Compound Name | 1-methyl-1,2,3,4-tetrahydrochromeno[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 12051006 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 1-methyl-1,2,3,4-tetrahydrochromeno[3,4-b]pyridin-5-one |
| SMILES | CC1CCNc2c1c1ccccc1oc2=O |
| InChI | InChI=1S/C13H13NO2/c1-8-6-7-14-12-11(8)9-4-2-3-5-10(9)16-13(12)15/h2-5,8,14H,6-7H2,1H3 |
| InChIKey | HHJCZQITXWMFGW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|