C12H10O2S — CID 15921865
2-methyl-1,2-dihydrothieno[2,3-c]chromen-4-one (PubChem CID 15921865) has the molecular formula C12H10O2S and a molecular weight of 218.28 g/mol. Its IUPAC name is 2-methyl-1,2-dihydrothieno[2,3-c]chromen-4-one.
| Compound Name | 2-methyl-1,2-dihydrothieno[2,3-c]chromen-4-one |
|---|---|
| PubChem CID | 15921865 |
| Molecular Formula | C12H10O2S |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | 2-methyl-1,2-dihydrothieno[2,3-c]chromen-4-one |
| SMILES | CC1Cc2c(c(=O)oc3ccccc23)S1 |
| InChI | InChI=1S/C12H10O2S/c1-7-6-9-8-4-2-3-5-10(8)14-12(13)11(9)15-7/h2-5,7H,6H2,1H3 |
| InChIKey | WCDQRNSJROCROK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|