C12H11NO2 — CID 13136922
1,2,3,4-tetrahydrochromeno[3,4-c]pyridin-5-one (PubChem CID 13136922) has the molecular formula C12H11NO2 and a molecular weight of 201.23 g/mol. Its IUPAC name is 1,2,3,4-tetrahydrochromeno[3,4-c]pyridin-5-one.
| Compound Name | 1,2,3,4-tetrahydrochromeno[3,4-c]pyridin-5-one |
|---|---|
| PubChem CID | 13136922 |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 1,2,3,4-tetrahydrochromeno[3,4-c]pyridin-5-one |
| SMILES | O=c1oc2ccccc2c2c1CNCC2 |
| InChI | InChI=1S/C12H11NO2/c14-12-10-7-13-6-5-8(10)9-3-1-2-4-11(9)15-12/h1-4,13H,5-7H2 |
| InChIKey | UWYCVSAHAGGILC-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|