C12H8O3 — CID 14174753
2H-pyrano[3,2-c]chromen-5-one (PubChem CID 14174753) has the molecular formula C12H8O3 and a molecular weight of 200.19 g/mol. Its IUPAC name is 2H-pyrano[3,2-c]chromen-5-one.
| Compound Name | 2H-pyrano[3,2-c]chromen-5-one |
|---|---|
| PubChem CID | 14174753 |
| Molecular Formula | C12H8O3 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | 2H-pyrano[3,2-c]chromen-5-one |
| SMILES | O=c1oc2ccccc2c2c1C=CCO2 |
| InChI | InChI=1S/C12H8O3/c13-12-9-5-3-7-14-11(9)8-4-1-2-6-10(8)15-12/h1-6H,7H2 |
| InChIKey | RJHDHCAQGSQPKA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|