C16H20O4Si — CID 139068634
(2R)-2-methyl-2-trimethylsilyloxy-3,4-dihydropyrano[3,2-c]chromen-5-one (PubChem CID 139068634) has the molecular formula C16H20O4Si and a molecular weight of 304.42 g/mol. Its IUPAC name is (2R)-2-methyl-2-trimethylsilyloxy-3,4-dihydropyrano[3,2-c]chromen-5-one.
| Compound Name | (2R)-2-methyl-2-trimethylsilyloxy-3,4-dihydropyrano[3,2-c]chromen-5-one |
|---|---|
| PubChem CID | 139068634 |
| Molecular Formula | C16H20O4Si |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | (2R)-2-methyl-2-trimethylsilyloxy-3,4-dihydropyrano[3,2-c]chromen-5-one |
| SMILES | C[C@@]1(O[Si](C)(C)C)CCc2c(c3ccccc3oc2=O)O1 |
| InChI | InChI=1S/C16H20O4Si/c1-16(20-21(2,3)4)10-9-12-14(19-16)11-7-5-6-8-13(11)18-15(12)17/h5-8H,9-10H2,1-4H3/t16-/m1/s1 |
| InChIKey | PNJYVJZYFDRXST-MRXNPFEDSA-N |
| XLogP | 3.69 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|