C15H12O5 — CID 11022018
(11R,15R)-11,15-dimethyl-8,14,16-trioxatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6-tetraene-9,13-dione (PubChem CID 11022018) has the molecular formula C15H12O5 and a molecular weight of 272.26 g/mol. Its IUPAC name is (11R,15R)-11,15-dimethyl-8,14,16-trioxatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6-tetraene-9,13-dione.
| Compound Name | (11R,15R)-11,15-dimethyl-8,14,16-trioxatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6-tetraene-9,13-dione |
|---|---|
| PubChem CID | 11022018 |
| Molecular Formula | C15H12O5 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | (11R,15R)-11,15-dimethyl-8,14,16-trioxatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6-tetraene-9,13-dione |
| SMILES | C[C@@]12OC(=O)C[C@]1(C)c1c(c3ccccc3oc1=O)O2 |
| InChI | InChI=1S/C15H12O5/c1-14-7-10(16)19-15(14,2)20-12-8-5-3-4-6-9(8)18-13(17)11(12)14/h3-6H,7H2,1-2H3/t14-,15+/m1/s1 |
| InChIKey | GSTBTFLSFHXBBS-CABCVRRESA-N |
| XLogP | 2.11 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|