C15H14O3 — CID 13244741
2,2,4-trimethylpyrano[3,2-c]chromen-5-one (PubChem CID 13244741) has the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. Its IUPAC name is 2,2,4-trimethylpyrano[3,2-c]chromen-5-one.
| Compound Name | 2,2,4-trimethylpyrano[3,2-c]chromen-5-one |
|---|---|
| PubChem CID | 13244741 |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 2,2,4-trimethylpyrano[3,2-c]chromen-5-one |
| SMILES | CC1=CC(C)(C)Oc2c1c(=O)oc1ccccc21 |
| InChI | InChI=1S/C15H14O3/c1-9-8-15(2,3)18-13-10-6-4-5-7-11(10)17-14(16)12(9)13/h4-8H,1-3H3 |
| InChIKey | VWECSCQVQXTNKO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|