About 2-methoxy-2,3-dihydrofuro[3,2-c]chromen-4-one
2-methoxy-2,3-dihydrofuro[3,2-c]chromen-4-one (PubChem CID 141108522) has the molecular formula C12H10O4
and a molecular weight of 218.21 g/mol. Its IUPAC name is 2-methoxy-2,3-dihydrofuro[3,2-c]chromen-4-one.
Molecular Properties
| Compound Name | 2-methoxy-2,3-dihydrofuro[3,2-c]chromen-4-one |
| PubChem CID | 141108522 |
| Molecular Formula | C12H10O4 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 2-methoxy-2,3-dihydrofuro[3,2-c]chromen-4-one |
| SMILES | COC1Cc2c(c3ccccc3oc2=O)O1 |
| InChI | InChI=1S/C12H10O4/c1-14-10-6-8-11(16-10)7-4-2-3-5-9(7)15-12(8)13/h2-5,10H,6H2,1H3 |
| InChIKey | FCTJCKJLRZNPJN-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-2,3-dihydrofuro[3,2-c]chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-2,3-dihydrofuro[3,2-c]chromen-4-one?
The IUPAC name of 2-methoxy-2,3-dihydrofuro[3,2-c]chromen-4-one (CID 141108522) is 2-methoxy-2,3-dihydrofuro[3,2-c]chromen-4-one.
What is the SMILES notation for 2-methoxy-2,3-dihydrofuro[3,2-c]chromen-4-one?
The canonical SMILES for 2-methoxy-2,3-dihydrofuro[3,2-c]chromen-4-one is COC1Cc2c(c3ccccc3oc2=O)O1.
What is the InChIKey of 2-methoxy-2,3-dihydrofuro[3,2-c]chromen-4-one?
The InChIKey is FCTJCKJLRZNPJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O4/c1-14-10-6-8-11(16-10)7-4-2-3-5-9(7)15-12(8)13/h2-5,10H,6H2,1H3.
What are the key properties of 2-methoxy-2,3-dihydrofuro[3,2-c]chromen-4-one?
2-methoxy-2,3-dihydrofuro[3,2-c]chromen-4-one has a molecular weight of 218.21 g/mol, XLogP of 1.70, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-2,3-dihydrofuro[3,2-c]chromen-4-one is sourced from PubChem (CID 141108522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).