C15H14O5 — CID 11832587
3-hydroxy-3-(4-oxo-2,3-dihydrofuro[3,2-c]chromen-2-yl)butanal (PubChem CID 11832587) has the molecular formula C15H14O5 and a molecular weight of 274.27 g/mol. Its IUPAC name is 3-hydroxy-3-(4-oxo-2,3-dihydrofuro[3,2-c]chromen-2-yl)butanal.
| Compound Name | 3-hydroxy-3-(4-oxo-2,3-dihydrofuro[3,2-c]chromen-2-yl)butanal |
|---|---|
| PubChem CID | 11832587 |
| Molecular Formula | C15H14O5 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 3-hydroxy-3-(4-oxo-2,3-dihydrofuro[3,2-c]chromen-2-yl)butanal |
| SMILES | CC(O)(CC=O)C1Cc2c(c3ccccc3oc2=O)O1 |
| InChI | InChI=1S/C15H14O5/c1-15(18,6-7-16)12-8-10-13(20-12)9-4-2-3-5-11(9)19-14(10)17/h2-5,7,12,18H,6,8H2,1H3 |
| InChIKey | NIUUJYUVPHMDEL-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|