C15H16O6 — CID 72993679
8-(1,2-dihydroxypropan-2-yl)-6-methoxy-8,9-dihydrofuro[2,3-h]chromen-2-one (PubChem CID 72993679) has the molecular formula C15H16O6 and a molecular weight of 292.29 g/mol. Its IUPAC name is 8-(1,2-dihydroxypropan-2-yl)-6-methoxy-8,9-dihydrofuro[2,3-h]chromen-2-one.
| Compound Name | 8-(1,2-dihydroxypropan-2-yl)-6-methoxy-8,9-dihydrofuro[2,3-h]chromen-2-one |
|---|---|
| PubChem CID | 72993679 |
| Molecular Formula | C15H16O6 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 8-(1,2-dihydroxypropan-2-yl)-6-methoxy-8,9-dihydrofuro[2,3-h]chromen-2-one |
| SMILES | COc1cc2ccc(=O)oc2c2c1OC(C(C)(O)CO)C2 |
| InChI | InChI=1S/C15H16O6/c1-15(18,7-16)11-6-9-13-8(3-4-12(17)21-13)5-10(19-2)14(9)20-11/h3-5,11,16,18H,6-7H2,1-2H3 |
| InChIKey | NBGLTUMCBPGOJY-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|