C18H20O5 — CID 162933974
2-[(8R)-2-oxo-8,9-dihydrofuro[2,3-h]chromen-8-yl]propan-2-yl 2-methylpropanoate (PubChem CID 162933974) has the molecular formula C18H20O5 and a molecular weight of 316.35 g/mol. Its IUPAC name is 2-[(8R)-2-oxo-8,9-dihydrofuro[2,3-h]chromen-8-yl]propan-2-yl 2-methylpropanoate.
| Compound Name | 2-[(8R)-2-oxo-8,9-dihydrofuro[2,3-h]chromen-8-yl]propan-2-yl 2-methylpropanoate |
|---|---|
| PubChem CID | 162933974 |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 2-[(8R)-2-oxo-8,9-dihydrofuro[2,3-h]chromen-8-yl]propan-2-yl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC(C)(C)[C@H]1Cc2c(ccc3ccc(=O)oc23)O1 |
| InChI | InChI=1S/C18H20O5/c1-10(2)17(20)23-18(3,4)14-9-12-13(21-14)7-5-11-6-8-15(19)22-16(11)12/h5-8,10,14H,9H2,1-4H3/t14-/m1/s1 |
| InChIKey | JBQHVGSHZLWWDC-CQSZACIVSA-N |
| XLogP | 3.07 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|